C25H24N6O8 — CID 10554360
(3S)-3-[[2-[(4E)-4-[(4-carbamimidoylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-[[(S)-carboxy(phenyl)methyl]amino]-4-oxobutanoic acid (PubChem CID 10554360) has the molecular formula C25H24N6O8 and a molecular weight of 536.50 g/mol. Its IUPAC name is (3S)-3-[[2-[(4E)-4-[(4-carbamimidoylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-[[(S)-carboxy(phenyl)methyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-[(4E)-4-[(4-carbamimidoylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-[[(S)-carboxy(phenyl)methyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10554360 |
| Molecular Formula | C25H24N6O8 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (3S)-3-[[2-[(4E)-4-[(4-carbamimidoylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-[[(S)-carboxy(phenyl)methyl]amino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(/C=C2/NC(=O)N(CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H24N6O8/c26-21(27)15-8-6-13(7-9-15)10-17-23(36)31(25(39)29-17)12-18(32)28-16(11-19(33)34)22(35)30-20(24(37)38)14-4-2-1-3-5-14/h1-10,16,20H,11-12H2,(H3,26,27)(H,28,32)(H,29,39)(H,30,35)(H,33,34)(H,37,38)/b17-10+/t16-,20-/m0/s1 |
| InChIKey | BTVKJDAIESQQMV-XMUIZGOESA-N |
| XLogP | -0.24 |
| TPSA | 232.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|