C29H41N5O3 — CID 172773145
4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine;(2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetic acid (PubChem CID 172773145) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine;(2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetic acid.
| Compound Name | 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine;(2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 172773145 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine;(2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetic acid |
| SMILES | NC1CCC(CC2CCC(N)CC2)CC1.[H]/N=C(\N)c1cccc(C(=O)N[C@@H](C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3O3.C13H26N2/c17-14(18)11-7-4-8-12(9-11)15(20)19-13(16(21)22)10-5-2-1-3-6-10;14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-9,13H,(H3,17,18)(H,19,20)(H,21,22);10-13H,1-9,14-15H2/t13-;/m1./s1 |
| InChIKey | NFPLURMQCLLZFZ-BTQNPOSSSA-N |
| XLogP | 3.94 |
| TPSA | 168.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|