C23H28N4O3 — CID 11811639
2-piperidin-4-ylethyl (2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetate (PubChem CID 11811639) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-piperidin-4-ylethyl (2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetate.
| Compound Name | 2-piperidin-4-ylethyl (2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 11811639 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-piperidin-4-ylethyl (2R)-2-[(3-carbamimidoylbenzoyl)amino]-2-phenylacetate |
| SMILES | [H]/N=C(\N)c1cccc(C(=O)N[C@@H](C(=O)OCCC2CCNCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H28N4O3/c24-21(25)18-7-4-8-19(15-18)22(28)27-20(17-5-2-1-3-6-17)23(29)30-14-11-16-9-12-26-13-10-16/h1-8,15-16,20,26H,9-14H2,(H3,24,25)(H,27,28)/t20-/m1/s1 |
| InChIKey | FLOAYQIDXDLTEU-HXUWFJFHSA-N |
| XLogP | 2.37 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|