C24H28ClN3O2 — CID 69309605
3-chloro-N-[(1R)-1-phenyl-2-(2-piperidin-4-ylethoxy)ethyl]-1H-indole-6-carboxamide (PubChem CID 69309605) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-phenyl-2-(2-piperidin-4-ylethoxy)ethyl]-1H-indole-6-carboxamide.
| Compound Name | 3-chloro-N-[(1R)-1-phenyl-2-(2-piperidin-4-ylethoxy)ethyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 69309605 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-chloro-N-[(1R)-1-phenyl-2-(2-piperidin-4-ylethoxy)ethyl]-1H-indole-6-carboxamide |
| SMILES | O=C(N[C@@H](COCCC1CCNCC1)c1ccccc1)c1ccc2c(Cl)c[nH]c2c1 |
| InChI | InChI=1S/C24H28ClN3O2/c25-21-15-27-22-14-19(6-7-20(21)22)24(29)28-23(18-4-2-1-3-5-18)16-30-13-10-17-8-11-26-12-9-17/h1-7,14-15,17,23,26-27H,8-13,16H2,(H,28,29)/t23-/m0/s1 |
| InChIKey | YENNXPIUNBHQGM-QHCPKHFHSA-N |
| XLogP | 4.70 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|