C23H25Cl2N3O2 — CID 69309648
5-chloro-N-[1-(2-chlorophenyl)-2-(piperidin-4-ylmethoxy)ethyl]-1H-indole-2-carboxamide (PubChem CID 69309648) has the molecular formula C23H25Cl2N3O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 5-chloro-N-[1-(2-chlorophenyl)-2-(piperidin-4-ylmethoxy)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[1-(2-chlorophenyl)-2-(piperidin-4-ylmethoxy)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 69309648 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-chloro-N-[1-(2-chlorophenyl)-2-(piperidin-4-ylmethoxy)ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC(COCC1CCNCC1)c1ccccc1Cl)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C23H25Cl2N3O2/c24-17-5-6-20-16(11-17)12-21(27-20)23(29)28-22(18-3-1-2-4-19(18)25)14-30-13-15-7-9-26-10-8-15/h1-6,11-12,15,22,26-27H,7-10,13-14H2,(H,28,29) |
| InChIKey | HTNDCLVXGMSQAC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |