C26H32ClN4O2+ — CID 20790082
3-chloro-N-[(1R)-1-phenyl-2-[(1-propan-2-ylpiperidin-1-ium-1-carbonyl)amino]ethyl]-1H-indole-6-carboxamide (PubChem CID 20790082) has the molecular formula C26H32ClN4O2+ and a molecular weight of 468.02 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-phenyl-2-[(1-propan-2-ylpiperidin-1-ium-1-carbonyl)amino]ethyl]-1H-indole-6-carboxamide.
| Compound Name | 3-chloro-N-[(1R)-1-phenyl-2-[(1-propan-2-ylpiperidin-1-ium-1-carbonyl)amino]ethyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 20790082 |
| Molecular Formula | C26H32ClN4O2+ |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-chloro-N-[(1R)-1-phenyl-2-[(1-propan-2-ylpiperidin-1-ium-1-carbonyl)amino]ethyl]-1H-indole-6-carboxamide |
| SMILES | CC(C)[N+]1(C(=O)NC[C@H](NC(=O)c2ccc3c(Cl)c[nH]c3c2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C26H31ClN4O2/c1-18(2)31(13-7-4-8-14-31)26(33)29-17-24(19-9-5-3-6-10-19)30-25(32)20-11-12-21-22(27)16-28-23(21)15-20/h3,5-6,9-12,15-16,18,24H,4,7-8,13-14,17H2,1-2H3,(H2-,28,29,30,32,33)/p+1/t24-/m0/s1 |
| InChIKey | ACUZUOHLNWGOGD-DEOSSOPVSA-O |
| XLogP | 5.41 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|