C30H19N5O — CID 72954375
9,10-bis(dicyanomethylidene)-N-(1-phenylpropyl)anthracene-2-carboxamide (PubChem CID 72954375) has the molecular formula C30H19N5O and a molecular weight of 465.52 g/mol. Its IUPAC name is 9,10-bis(dicyanomethylidene)-N-(1-phenylpropyl)anthracene-2-carboxamide.
| Compound Name | 9,10-bis(dicyanomethylidene)-N-(1-phenylpropyl)anthracene-2-carboxamide |
|---|---|
| PubChem CID | 72954375 |
| Molecular Formula | C30H19N5O |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 9,10-bis(dicyanomethylidene)-N-(1-phenylpropyl)anthracene-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc2c(=C(C#N)C#N)c3ccccc3c(=C(C#N)C#N)c2c1)c1ccccc1 |
| InChI | InChI=1S/C30H19N5O/c1-2-27(19-8-4-3-5-9-19)35-30(36)20-12-13-25-26(14-20)29(22(17-33)18-34)24-11-7-6-10-23(24)28(25)21(15-31)16-32/h3-14,27H,2H2,1H3,(H,35,36) |
| InChIKey | SIDNBUCBMABEKT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|