C16H16ClNO3S — CID 95972136
3-chloro-4-hydroxy-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]benzamide (PubChem CID 95972136) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 95972136 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(1S)-2-[(S)-methylsulfinyl]-1-phenylethyl]benzamide |
| SMILES | C[S@](=O)C[C@@H](NC(=O)c1ccc(O)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO3S/c1-22(21)10-14(11-5-3-2-4-6-11)18-16(20)12-7-8-15(19)13(17)9-12/h2-9,14,19H,10H2,1H3,(H,18,20)/t14-,22+/m1/s1 |
| InChIKey | KBTQZAVOIXIWDS-PEBXRYMYSA-N |
| XLogP | 2.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |