C16H17N3O4S — CID 96522392
4-amino-N-[(1R)-2-[(R)-methylsulfinyl]-1-phenylethyl]-3-nitrobenzamide (PubChem CID 96522392) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 4-amino-N-[(1R)-2-[(R)-methylsulfinyl]-1-phenylethyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[(1R)-2-[(R)-methylsulfinyl]-1-phenylethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 96522392 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-amino-N-[(1R)-2-[(R)-methylsulfinyl]-1-phenylethyl]-3-nitrobenzamide |
| SMILES | C[S@@](=O)C[C@H](NC(=O)c1ccc(N)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-24(23)10-14(11-5-3-2-4-6-11)18-16(20)12-7-8-13(17)15(9-12)19(21)22/h2-9,14H,10,17H2,1H3,(H,18,20)/t14-,24+/m0/s1 |
| InChIKey | GKISAJNMSAFZPU-LFPIHBKWSA-N |
| XLogP | 2.03 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|