C16H16N2O5 — CID 102561312
4-hydroxy-N-(2-methoxy-1-phenylethyl)-3-nitrobenzamide (PubChem CID 102561312) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-hydroxy-N-(2-methoxy-1-phenylethyl)-3-nitrobenzamide.
| Compound Name | 4-hydroxy-N-(2-methoxy-1-phenylethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 102561312 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-hydroxy-N-(2-methoxy-1-phenylethyl)-3-nitrobenzamide |
| SMILES | COCC(NC(=O)c1ccc(O)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O5/c1-23-10-13(11-5-3-2-4-6-11)17-16(20)12-7-8-15(19)14(9-12)18(21)22/h2-9,13,19H,10H2,1H3,(H,17,20) |
| InChIKey | KHBHTAIWWPEHID-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|