C21H23IN2O3 — CID 163815345
[(3R)-4-(iodomethyl)piperidin-3-yl] 2-benzamido-2-phenylacetate (PubChem CID 163815345) has the molecular formula C21H23IN2O3 and a molecular weight of 478.33 g/mol. Its IUPAC name is [(3R)-4-(iodomethyl)piperidin-3-yl] 2-benzamido-2-phenylacetate.
| Compound Name | [(3R)-4-(iodomethyl)piperidin-3-yl] 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 163815345 |
| Molecular Formula | C21H23IN2O3 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | [(3R)-4-(iodomethyl)piperidin-3-yl] 2-benzamido-2-phenylacetate |
| SMILES | O=C(NC(C(=O)O[C@H]1CNCCC1CI)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23IN2O3/c22-13-17-11-12-23-14-18(17)27-21(26)19(15-7-3-1-4-8-15)24-20(25)16-9-5-2-6-10-16/h1-10,17-19,23H,11-14H2,(H,24,25)/t17?,18-,19?/m0/s1 |
| InChIKey | NQVQPIIRMGLLPL-XBMUEBEBSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|