C23H35N5O2 — CID 101104395
N-[(1R)-2-[[4-(aminomethyl)cyclohexyl]amino]-1-cyclohexyl-2-oxoethyl]-3-carbamimidoylbenzamide (PubChem CID 101104395) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[(1R)-2-[[4-(aminomethyl)cyclohexyl]amino]-1-cyclohexyl-2-oxoethyl]-3-carbamimidoylbenzamide.
| Compound Name | N-[(1R)-2-[[4-(aminomethyl)cyclohexyl]amino]-1-cyclohexyl-2-oxoethyl]-3-carbamimidoylbenzamide |
|---|---|
| PubChem CID | 101104395 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-[(1R)-2-[[4-(aminomethyl)cyclohexyl]amino]-1-cyclohexyl-2-oxoethyl]-3-carbamimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1cccc(C(=O)N[C@@H](C(=O)NC2CCC(CN)CC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H35N5O2/c24-14-15-9-11-19(12-10-15)27-23(30)20(16-5-2-1-3-6-16)28-22(29)18-8-4-7-17(13-18)21(25)26/h4,7-8,13,15-16,19-20H,1-3,5-6,9-12,14,24H2,(H3,25,26)(H,27,30)(H,28,29)/t15?,19?,20-/m1/s1 |
| InChIKey | UHULTMDYIIRMHV-RGKRWLCDSA-N |
| XLogP | 2.28 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|