C29H38N6O4 — CID 22460922
2-[(4-carbamimidoylphenyl)methyl]-N-[2-[(3-carbamoylphenyl)methylamino]-1-cyclohexyl-2-oxoethyl]-N',N'-dimethylpropanediamide (PubChem CID 22460922) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[(4-carbamimidoylphenyl)methyl]-N-[2-[(3-carbamoylphenyl)methylamino]-1-cyclohexyl-2-oxoethyl]-N',N'-dimethylpropanediamide.
| Compound Name | 2-[(4-carbamimidoylphenyl)methyl]-N-[2-[(3-carbamoylphenyl)methylamino]-1-cyclohexyl-2-oxoethyl]-N',N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 22460922 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 2-[(4-carbamimidoylphenyl)methyl]-N-[2-[(3-carbamoylphenyl)methylamino]-1-cyclohexyl-2-oxoethyl]-N',N'-dimethylpropanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)NC(C(=O)NCc2cccc(C(N)=O)c2)C2CCCCC2)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C29H38N6O4/c1-35(2)29(39)23(16-18-11-13-21(14-12-18)25(30)31)27(37)34-24(20-8-4-3-5-9-20)28(38)33-17-19-7-6-10-22(15-19)26(32)36/h6-7,10-15,20,23-24H,3-5,8-9,16-17H2,1-2H3,(H3,30,31)(H2,32,36)(H,33,38)(H,34,37) |
| InChIKey | IFBYFESTPMETIG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|