C27H43N7O4 — CID 70219547
N-[(1S)-2-[4-aminobutylcarbamoyl(methyl)amino]-1-cyclohexyl-2-oxoethyl]-2-[(4-carbamimidoylphenyl)methyl]-N',N'-dimethylpropanediamide (PubChem CID 70219547) has the molecular formula C27H43N7O4 and a molecular weight of 529.69 g/mol. Its IUPAC name is N-[(1S)-2-[4-aminobutylcarbamoyl(methyl)amino]-1-cyclohexyl-2-oxoethyl]-2-[(4-carbamimidoylphenyl)methyl]-N',N'-dimethylpropanediamide.
| Compound Name | N-[(1S)-2-[4-aminobutylcarbamoyl(methyl)amino]-1-cyclohexyl-2-oxoethyl]-2-[(4-carbamimidoylphenyl)methyl]-N',N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 70219547 |
| Molecular Formula | C27H43N7O4 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | N-[(1S)-2-[4-aminobutylcarbamoyl(methyl)amino]-1-cyclohexyl-2-oxoethyl]-2-[(4-carbamimidoylphenyl)methyl]-N',N'-dimethylpropanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)N[C@H](C(=O)N(C)C(=O)NCCCCN)C2CCCCC2)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C27H43N7O4/c1-33(2)25(36)21(17-18-11-13-20(14-12-18)23(29)30)24(35)32-22(19-9-5-4-6-10-19)26(37)34(3)27(38)31-16-8-7-15-28/h11-14,19,21-22H,4-10,15-17,28H2,1-3H3,(H3,29,30)(H,31,38)(H,32,35)/t21?,22-/m0/s1 |
| InChIKey | NUBQELDHWUZYCU-KEKNWZKVSA-N |
| XLogP | 1.19 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|