C25H39N5O6 — CID 87869811
(2S)-2-[[(2S)-2-acetamido-3-(4-carbamimidoylphenyl)propanoyl]amino]-2-cyclohexylacetic acid;2-(trimethylazaniumyl)acetate (PubChem CID 87869811) has the molecular formula C25H39N5O6 and a molecular weight of 505.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-(4-carbamimidoylphenyl)propanoyl]amino]-2-cyclohexylacetic acid;2-(trimethylazaniumyl)acetate.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-(4-carbamimidoylphenyl)propanoyl]amino]-2-cyclohexylacetic acid;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 87869811 |
| Molecular Formula | C25H39N5O6 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-(4-carbamimidoylphenyl)propanoyl]amino]-2-cyclohexylacetic acid;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].[H]/N=C(\N)c1ccc(C[C@H](NC(C)=O)C(=O)N[C@H](C(=O)O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H28N4O4.C5H11NO2/c1-12(25)23-16(11-13-7-9-15(10-8-13)18(21)22)19(26)24-17(20(27)28)14-5-3-2-4-6-14;1-6(2,3)4-5(7)8/h7-10,14,16-17H,2-6,11H2,1H3,(H3,21,22)(H,23,25)(H,24,26)(H,27,28);4H2,1-3H3/t16-,17-;/m0./s1 |
| InChIKey | KIEOTFPXXJRUSI-QJHJCNPRSA-N |
| XLogP | -0.39 |
| TPSA | 185.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|