C36H51N6O6+ — CID 10439372
cyclohexylmethyl N-[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-aminophenyl)propanoyl]amino]-2-cyclohexylacetyl]amino]-3-(1-methylpyridin-1-ium-3-yl)propanoyl]carbamate (PubChem CID 10439372) has the molecular formula C36H51N6O6+ and a molecular weight of 663.84 g/mol. Its IUPAC name is cyclohexylmethyl N-[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-aminophenyl)propanoyl]amino]-2-cyclohexylacetyl]amino]-3-(1-methylpyridin-1-ium-3-yl)propanoyl]carbamate.
| Compound Name | cyclohexylmethyl N-[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-aminophenyl)propanoyl]amino]-2-cyclohexylacetyl]amino]-3-(1-methylpyridin-1-ium-3-yl)propanoyl]carbamate |
|---|---|
| PubChem CID | 10439372 |
| Molecular Formula | C36H51N6O6+ |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.39 |
| IUPAC Name | cyclohexylmethyl N-[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-aminophenyl)propanoyl]amino]-2-cyclohexylacetyl]amino]-3-(1-methylpyridin-1-ium-3-yl)propanoyl]carbamate |
| SMILES | CC(=O)N[C@@H](Cc1ccc(N)cc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc[n+](C)c1)C(=O)NC(=O)OCC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C36H50N6O6/c1-24(43)38-30(20-25-15-17-29(37)18-16-25)33(44)40-32(28-13-7-4-8-14-28)35(46)39-31(21-27-12-9-19-42(2)22-27)34(45)41-36(47)48-23-26-10-5-3-6-11-26/h9,12,15-19,22,26,28,30-32H,3-8,10-11,13-14,20-21,23,37H2,1-2H3,(H3-,38,39,40,41,43,44,45,46,47)/p+1/t30-,31-,32-/m0/s1 |
| InChIKey | KGWRBBXQPPNNDB-CPCREDONSA-O |
| XLogP | 2.77 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|