C23H36N2O3 — CID 71411659
(2S)-2-acetamido-3-phenylpropanoic acid;N-cyclohexylcyclohexanamine (PubChem CID 71411659) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is (2S)-2-acetamido-3-phenylpropanoic acid;N-cyclohexylcyclohexanamine.
| Compound Name | (2S)-2-acetamido-3-phenylpropanoic acid;N-cyclohexylcyclohexanamine |
|---|---|
| PubChem CID | 71411659 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | (2S)-2-acetamido-3-phenylpropanoic acid;N-cyclohexylcyclohexanamine |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H23N.C11H13NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h11-13H,1-10H2;2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t;10-/m.0/s1 |
| InChIKey | QMIHRZIDQZBWHV-CICJTZRQSA-N |
| XLogP | 4.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |