C22H34N2O4 — CID 71352551
N-cyclohexylcyclohexanamine;(2S)-2-formamido-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 71352551) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;(2S)-2-formamido-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | N-cyclohexylcyclohexanamine;(2S)-2-formamido-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 71352551 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N-cyclohexylcyclohexanamine;(2S)-2-formamido-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=CN[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C12H23N.C10H11NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;12-6-11-9(10(14)15)5-7-1-3-8(13)4-2-7/h11-13H,1-10H2;1-4,6,9,13H,5H2,(H,11,12)(H,14,15)/t;9-/m.0/s1 |
| InChIKey | USCUTVRCRUIOPX-NPULLEENSA-N |
| XLogP | 3.38 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|