C24H36N2O4 — CID 21140054
N-cyclohexylcyclohexanamine;(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoic acid (PubChem CID 21140054) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoic acid.
| Compound Name | N-cyclohexylcyclohexanamine;(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 21140054 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | N-cyclohexylcyclohexanamine;(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.C=COC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H13NO4.C12H23N/c1-2-17-12(16)13-10(11(14)15)8-9-6-4-3-5-7-9;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h2-7,10H,1,8H2,(H,13,16)(H,14,15);11-13H,1-10H2/t10-;/m0./s1 |
| InChIKey | GNGIRZHRNUHEDE-PPHPATTJSA-N |
| XLogP | 4.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|