C14H19NO3 — CID 18352519
2-(cyclopentylamino)-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18352519) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(cyclopentylamino)-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-(cyclopentylamino)-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18352519 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(cyclopentylamino)-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)NC1CCCC1 |
| InChI | InChI=1S/C14H19NO3/c16-12-7-5-10(6-8-12)9-13(14(17)18)15-11-3-1-2-4-11/h5-8,11,13,15-16H,1-4,9H2,(H,17,18) |
| InChIKey | DLLJLLLKUILULN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |