C19H27NO3 — CID 90680452
[(1S)-1-cyclohexylethyl] (2S)-2-acetamido-3-phenylpropanoate (PubChem CID 90680452) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is [(1S)-1-cyclohexylethyl] (2S)-2-acetamido-3-phenylpropanoate.
| Compound Name | [(1S)-1-cyclohexylethyl] (2S)-2-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 90680452 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(1S)-1-cyclohexylethyl] (2S)-2-acetamido-3-phenylpropanoate |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)O[C@@H](C)C1CCCCC1 |
| InChI | InChI=1S/C19H27NO3/c1-14(17-11-7-4-8-12-17)23-19(22)18(20-15(2)21)13-16-9-5-3-6-10-16/h3,5-6,9-10,14,17-18H,4,7-8,11-13H2,1-2H3,(H,20,21)/t14-,18-/m0/s1 |
| InChIKey | RSUDQXIJJUUIMM-KSSFIOAISA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |