C15H21NO3 — CID 90680450
[(2S)-butan-2-yl] (2S)-2-acetamido-3-phenylpropanoate (PubChem CID 90680450) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (2S)-2-acetamido-3-phenylpropanoate.
| Compound Name | [(2S)-butan-2-yl] (2S)-2-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 90680450 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [(2S)-butan-2-yl] (2S)-2-acetamido-3-phenylpropanoate |
| SMILES | CC[C@H](C)OC(=O)[C@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C15H21NO3/c1-4-11(2)19-15(18)14(16-12(3)17)10-13-8-6-5-7-9-13/h5-9,11,14H,4,10H2,1-3H3,(H,16,17)/t11-,14-/m0/s1 |
| InChIKey | ZDVMPCFPOZDRQL-FZMZJTMJSA-N |
| XLogP | 2.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |