C22H32N2O4 — CID 7326241
methyl (2R)-2-[[(3S)-5-(cyclohexylamino)-3-methyl-5-oxopentanoyl]amino]-3-phenylpropanoate (PubChem CID 7326241) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is methyl (2R)-2-[[(3S)-5-(cyclohexylamino)-3-methyl-5-oxopentanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[(3S)-5-(cyclohexylamino)-3-methyl-5-oxopentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7326241 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | methyl (2R)-2-[[(3S)-5-(cyclohexylamino)-3-methyl-5-oxopentanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)C[C@@H](C)CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H32N2O4/c1-16(13-20(25)23-18-11-7-4-8-12-18)14-21(26)24-19(22(27)28-2)15-17-9-5-3-6-10-17/h3,5-6,9-10,16,18-19H,4,7-8,11-15H2,1-2H3,(H,23,25)(H,24,26)/t16-,19+/m0/s1 |
| InChIKey | XTWVEXMUEJYYOW-QFBILLFUSA-N |
| XLogP | 2.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |