C19H25NO5 — CID 9017205
[2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 9017205) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 9017205 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [2-[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H25NO5/c1-24-19(23)16(12-14-8-4-2-5-9-14)20-17(21)13-25-18(22)15-10-6-3-7-11-15/h2,4-5,8-9,15-16H,3,6-7,10-13H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | VPXFPQCGMAXOHM-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |