C20H30N2O4 — CID 78826843
methyl 2-[[2-[cyclohexyl(2-hydroxyethyl)amino]acetyl]amino]-3-phenylpropanoate (PubChem CID 78826843) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 2-[[2-[cyclohexyl(2-hydroxyethyl)amino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-[cyclohexyl(2-hydroxyethyl)amino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 78826843 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methyl 2-[[2-[cyclohexyl(2-hydroxyethyl)amino]acetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CN(CCO)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O4/c1-26-20(25)18(14-16-8-4-2-5-9-16)21-19(24)15-22(12-13-23)17-10-6-3-7-11-17/h2,4-5,8-9,17-18,23H,3,6-7,10-15H2,1H3,(H,21,24) |
| InChIKey | GYRFPYMDVBEEJI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |