C17H26N2O5 — CID 102262378
methyl (2S)-2-[3-[bis(2-hydroxyethyl)amino]propanoylamino]-3-phenylpropanoate (PubChem CID 102262378) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl (2S)-2-[3-[bis(2-hydroxyethyl)amino]propanoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[3-[bis(2-hydroxyethyl)amino]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102262378 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | methyl (2S)-2-[3-[bis(2-hydroxyethyl)amino]propanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CCN(CCO)CCO |
| InChI | InChI=1S/C17H26N2O5/c1-24-17(23)15(13-14-5-3-2-4-6-14)18-16(22)7-8-19(9-11-20)10-12-21/h2-6,15,20-21H,7-13H2,1H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | NMDNZDLSIMUWDC-HNNXBMFYSA-N |
| XLogP | -0.44 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |