C22H37N3O3 — CID 4647807
methyl 2-[3-(dibutylamino)propylcarbamoylamino]-3-phenylpropanoate (PubChem CID 4647807) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is methyl 2-[3-(dibutylamino)propylcarbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[3-(dibutylamino)propylcarbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 4647807 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | methyl 2-[3-(dibutylamino)propylcarbamoylamino]-3-phenylpropanoate |
| SMILES | CCCCN(CCCC)CCCNC(=O)NC(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C22H37N3O3/c1-4-6-15-25(16-7-5-2)17-11-14-23-22(27)24-20(21(26)28-3)18-19-12-9-8-10-13-19/h8-10,12-13,20H,4-7,11,14-18H2,1-3H3,(H2,23,24,27) |
| InChIKey | PKUQJDURVBTURK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|