C21H38N2O2 — CID 139484362
2-amino-3-phenylpropanoic acid;N,N-dibutylbutan-1-amine (PubChem CID 139484362) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;N,N-dibutylbutan-1-amine.
| Compound Name | 2-amino-3-phenylpropanoic acid;N,N-dibutylbutan-1-amine |
|---|---|
| PubChem CID | 139484362 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;N,N-dibutylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCCC.NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H27N.C9H11NO2/c1-4-7-10-13(11-8-5-2)12-9-6-3;10-8(9(11)12)6-7-4-2-1-3-5-7/h4-12H2,1-3H3;1-5,8H,6,10H2,(H,11,12) |
| InChIKey | RRZKQJAGUMUWQS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |