C22H33NO4 — CID 156884413
methyl (2S)-2-[(1-cyclohexyl-2-phenylethoxy)carbonylamino]-4-methylpentanoate (PubChem CID 156884413) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is methyl (2S)-2-[(1-cyclohexyl-2-phenylethoxy)carbonylamino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[(1-cyclohexyl-2-phenylethoxy)carbonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 156884413 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | methyl (2S)-2-[(1-cyclohexyl-2-phenylethoxy)carbonylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)OC(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H33NO4/c1-16(2)14-19(21(24)26-3)23-22(25)27-20(18-12-8-5-9-13-18)15-17-10-6-4-7-11-17/h4,6-7,10-11,16,18-20H,5,8-9,12-15H2,1-3H3,(H,23,25)/t19-,20?/m0/s1 |
| InChIKey | WRWWQVFOGLZMMI-XJDOXCRVSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |