C23H27NO6 — CID 53360606
2-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxy-3-phenylpropanoic acid (PubChem CID 53360606) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxy-3-phenylpropanoic acid.
| Compound Name | 2-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 53360606 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]oxy-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)OC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H27NO6/c1-16(2)13-19(24-23(28)29-15-18-11-7-4-8-12-18)22(27)30-20(21(25)26)14-17-9-5-3-6-10-17/h3-12,16,19-20H,13-15H2,1-2H3,(H,24,28)(H,25,26)/t19-,20?/m0/s1 |
| InChIKey | CRGSYEDBDAVGKC-XJDOXCRVSA-N |
| XLogP | 3.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |