C29H37N3O6 — CID 155036039
methyl (2R)-3-[4-[[2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl]amino]phenyl]-2-(propanoylamino)propanoate (PubChem CID 155036039) has the molecular formula C29H37N3O6 and a molecular weight of 523.63 g/mol. Its IUPAC name is methyl (2R)-3-[4-[[2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl]amino]phenyl]-2-(propanoylamino)propanoate.
| Compound Name | methyl (2R)-3-[4-[[2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl]amino]phenyl]-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 155036039 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | methyl (2R)-3-[4-[[2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl]amino]phenyl]-2-(propanoylamino)propanoate |
| SMILES | CCC(=O)N[C@H](Cc1ccc(NC(=O)C(NC(=O)OCc2ccccc2)C2CCCCC2)cc1)C(=O)OC |
| InChI | InChI=1S/C29H37N3O6/c1-3-25(33)31-24(28(35)37-2)18-20-14-16-23(17-15-20)30-27(34)26(22-12-8-5-9-13-22)32-29(36)38-19-21-10-6-4-7-11-21/h4,6-7,10-11,14-17,22,24,26H,3,5,8-9,12-13,18-19H2,1-2H3,(H,30,34)(H,31,33)(H,32,36)/t24-,26?/m1/s1 |
| InChIKey | AXSPHUXLSCRIMD-RMVMEJTISA-N |
| XLogP | 4.11 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |