C21H29N3O5 — CID 67140444
methyl 4-[2-(2-acetamido-2-cyclopentylacetyl)hydrazinyl]-2-benzyl-4-oxobutanoate (PubChem CID 67140444) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 4-[2-(2-acetamido-2-cyclopentylacetyl)hydrazinyl]-2-benzyl-4-oxobutanoate.
| Compound Name | methyl 4-[2-(2-acetamido-2-cyclopentylacetyl)hydrazinyl]-2-benzyl-4-oxobutanoate |
|---|---|
| PubChem CID | 67140444 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | methyl 4-[2-(2-acetamido-2-cyclopentylacetyl)hydrazinyl]-2-benzyl-4-oxobutanoate |
| SMILES | COC(=O)C(CC(=O)NNC(=O)C(NC(C)=O)C1CCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C21H29N3O5/c1-14(25)22-19(16-10-6-7-11-16)20(27)24-23-18(26)13-17(21(28)29-2)12-15-8-4-3-5-9-15/h3-5,8-9,16-17,19H,6-7,10-13H2,1-2H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | UNRMGVRLFBKRKA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|