C23H33NO5 — CID 59137199
benzyl (3S)-3-[[(1S)-1-cyclohexyl-2-methoxy-2-oxoethyl]carbamoyl]-4-methylpentanoate (PubChem CID 59137199) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is benzyl (3S)-3-[[(1S)-1-cyclohexyl-2-methoxy-2-oxoethyl]carbamoyl]-4-methylpentanoate.
| Compound Name | benzyl (3S)-3-[[(1S)-1-cyclohexyl-2-methoxy-2-oxoethyl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 59137199 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | benzyl (3S)-3-[[(1S)-1-cyclohexyl-2-methoxy-2-oxoethyl]carbamoyl]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](NC(=O)C(CC(=O)OCc1ccccc1)C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C23H33NO5/c1-16(2)19(14-20(25)29-15-17-10-6-4-7-11-17)22(26)24-21(23(27)28-3)18-12-8-5-9-13-18/h4,6-7,10-11,16,18-19,21H,5,8-9,12-15H2,1-3H3,(H,24,26)/t19?,21-/m0/s1 |
| InChIKey | CZWARBYPNYGUQZ-QWAKEFERSA-N |
| XLogP | 3.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |