C19H27NO4 — CID 91596177
methyl 2-cyclohexyl-2-[[3-(4-hydroxyphenyl)-2-methylpropanoyl]amino]acetate (PubChem CID 91596177) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl 2-cyclohexyl-2-[[3-(4-hydroxyphenyl)-2-methylpropanoyl]amino]acetate.
| Compound Name | methyl 2-cyclohexyl-2-[[3-(4-hydroxyphenyl)-2-methylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 91596177 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | methyl 2-cyclohexyl-2-[[3-(4-hydroxyphenyl)-2-methylpropanoyl]amino]acetate |
| SMILES | COC(=O)C(NC(=O)C(C)Cc1ccc(O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C19H27NO4/c1-13(12-14-8-10-16(21)11-9-14)18(22)20-17(19(23)24-2)15-6-4-3-5-7-15/h8-11,13,15,17,21H,3-7,12H2,1-2H3,(H,20,22) |
| InChIKey | BOPLDFRWVQCLGL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |