C25H37N3O4 — CID 56990078
methyl (2S)-2-cyclohexyl-2-[[(2R)-2-cyclohexyl-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoyl]amino]acetate (PubChem CID 56990078) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is methyl (2S)-2-cyclohexyl-2-[[(2R)-2-cyclohexyl-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoyl]amino]acetate.
| Compound Name | methyl (2S)-2-cyclohexyl-2-[[(2R)-2-cyclohexyl-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 56990078 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | methyl (2S)-2-cyclohexyl-2-[[(2R)-2-cyclohexyl-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoyl]amino]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(C(N)=NO)cc1)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H37N3O4/c1-32-25(30)22(19-10-6-3-7-11-19)27-24(29)21(18-8-4-2-5-9-18)16-17-12-14-20(15-13-17)23(26)28-31/h12-15,18-19,21-22,31H,2-11,16H2,1H3,(H2,26,28)(H,27,29)/t21-,22+/m1/s1 |
| InChIKey | STRQKRKUTNSKQR-YADHBBJMSA-N |
| XLogP | 3.76 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|