C16H25N3O — CID 77025574
4-[(cyclooctylamino)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 77025574) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-[(cyclooctylamino)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(cyclooctylamino)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77025574 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 4-[(cyclooctylamino)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(CNC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C16H25N3O/c17-16(19-20)14-10-8-13(9-11-14)12-18-15-6-4-2-1-3-5-7-15/h8-11,15,18,20H,1-7,12H2,(H2,17,19) |
| InChIKey | KHJIDTMXPIYPOO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|