C18H26N2O3 — CID 146524756
methyl 2-cyclooctyl-2-[(2-pyridin-4-ylacetyl)amino]acetate (PubChem CID 146524756) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is methyl 2-cyclooctyl-2-[(2-pyridin-4-ylacetyl)amino]acetate.
| Compound Name | methyl 2-cyclooctyl-2-[(2-pyridin-4-ylacetyl)amino]acetate |
|---|---|
| PubChem CID | 146524756 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | methyl 2-cyclooctyl-2-[(2-pyridin-4-ylacetyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)Cc1ccncc1)C1CCCCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-23-18(22)17(15-7-5-3-2-4-6-8-15)20-16(21)13-14-9-11-19-12-10-14/h9-12,15,17H,2-8,13H2,1H3,(H,20,21) |
| InChIKey | NXICKYVTFMBUNI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |