C38H56N8O3 — CID 54117766
(2S)-2-[[2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)-N-(2-phenylethyl)pentanamide (PubChem CID 54117766) has the molecular formula C38H56N8O3 and a molecular weight of 672.92 g/mol. Its IUPAC name is (2S)-2-[[2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)-N-(2-phenylethyl)pentanamide.
| Compound Name | (2S)-2-[[2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 54117766 |
| Molecular Formula | C38H56N8O3 |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.45 |
| IUPAC Name | (2S)-2-[[2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)-N-(2-phenylethyl)pentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)NC(C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCCc2ccccc2)C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C38H56N8O3/c39-34(40)30-20-18-27(19-21-30)25-31(28-13-6-2-7-14-28)35(47)46-33(29-15-8-3-9-16-29)37(49)45-32(17-10-23-44-38(41)42)36(48)43-24-22-26-11-4-1-5-12-26/h1,4-5,11-12,18-21,28-29,31-33H,2-3,6-10,13-17,22-25H2,(H3,39,40)(H,43,48)(H,45,49)(H,46,47)(H4,41,42,44)/t31?,32-,33?/m0/s1 |
| InChIKey | NLNYEWRBIORYRY-OMYKBPHGSA-N |
| XLogP | 3.67 |
| TPSA | 201.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|