C30H41N7O4 — CID 152761429
(2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 152761429) has the molecular formula C30H41N7O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 152761429 |
| Molecular Formula | C30H41N7O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-2-cyclohexylacetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H41N7O4/c31-26(32)22-15-13-19(14-16-22)18-23(20-8-3-1-4-9-20)27(38)37-25(21-10-5-2-6-11-21)28(39)36-24(29(40)41)12-7-17-35-30(33)34/h1,3-4,8-9,13-16,21,23-25H,2,5-7,10-12,17-18H2,(H3,31,32)(H,36,39)(H,37,38)(H,40,41)(H4,33,34,35)/t23?,24-,25-/m0/s1 |
| InChIKey | WDZLLDMCGCIXQX-DJHGOXGWSA-N |
| XLogP | 1.99 |
| TPSA | 209.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|