C28H33F3N8O6 — CID 87983409
(3S)-4-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]imino-3-[[(2S)-3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-4-(2,2,2-trifluoroacetyl)oxybutanoic acid (PubChem CID 87983409) has the molecular formula C28H33F3N8O6 and a molecular weight of 634.62 g/mol. Its IUPAC name is (3S)-4-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]imino-3-[[(2S)-3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-4-(2,2,2-trifluoroacetyl)oxybutanoic acid.
| Compound Name | (3S)-4-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]imino-3-[[(2S)-3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-4-(2,2,2-trifluoroacetyl)oxybutanoic acid |
|---|---|
| PubChem CID | 87983409 |
| Molecular Formula | C28H33F3N8O6 |
| Molecular Weight | 634.62 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | (3S)-4-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]imino-3-[[(2S)-3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]amino]-4-(2,2,2-trifluoroacetyl)oxybutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H](C(=O)N[C@@H](CC(=O)O)/C(=N/[C@@H](CCCN=C(N)N)C(N)=O)OC(=O)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33F3N8O6/c29-28(30,31)26(44)45-25(39-19(23(34)42)7-4-12-37-27(35)36)20(14-21(40)41)38-24(43)18(16-5-2-1-3-6-16)13-15-8-10-17(11-9-15)22(32)33/h1-3,5-6,8-11,18-20H,4,7,12-14H2,(H3,32,33)(H2,34,42)(H,38,43)(H,40,41)(H4,35,36,37)/b39-25-/t18-,19-,20-/m0/s1 |
| InChIKey | GIIVCODEZZRSCT-VANCXWHASA-N |
| XLogP | 0.67 |
| TPSA | 262.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.62 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|