C31H37N9O4 — CID 23519912
N-[(1S)-2-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxo-1-phenylethyl]-2-[(4-carbamimidoylphenyl)methyl]-N'-phenylpropanediamide (PubChem CID 23519912) has the molecular formula C31H37N9O4 and a molecular weight of 599.70 g/mol. Its IUPAC name is N-[(1S)-2-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxo-1-phenylethyl]-2-[(4-carbamimidoylphenyl)methyl]-N'-phenylpropanediamide.
| Compound Name | N-[(1S)-2-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxo-1-phenylethyl]-2-[(4-carbamimidoylphenyl)methyl]-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 23519912 |
| Molecular Formula | C31H37N9O4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | N-[(1S)-2-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxo-1-phenylethyl]-2-[(4-carbamimidoylphenyl)methyl]-N'-phenylpropanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)Nc2ccccc2)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H37N9O4/c32-26(33)21-15-13-19(14-16-21)18-23(28(42)38-22-10-5-2-6-11-22)29(43)40-25(20-8-3-1-4-9-20)30(44)39-24(27(34)41)12-7-17-37-31(35)36/h1-6,8-11,13-16,23-25H,7,12,17-18H2,(H3,32,33)(H2,34,41)(H,38,42)(H,39,44)(H,40,43)(H4,35,36,37)/t23?,24-,25-/m0/s1 |
| InChIKey | UCZQMWSVCUNGSV-DJHGOXGWSA-N |
| XLogP | 0.65 |
| TPSA | 244.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|