C23H38N10O4 — CID 23519934
N-[(2S)-5-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-2-[(4-carbamimidoylphenyl)methyl]-N'-methylpropanediamide (PubChem CID 23519934) has the molecular formula C23H38N10O4 and a molecular weight of 518.62 g/mol. Its IUPAC name is N-[(2S)-5-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-2-[(4-carbamimidoylphenyl)methyl]-N'-methylpropanediamide.
| Compound Name | N-[(2S)-5-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-2-[(4-carbamimidoylphenyl)methyl]-N'-methylpropanediamide |
|---|---|
| PubChem CID | 23519934 |
| Molecular Formula | C23H38N10O4 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | N-[(2S)-5-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]-2-[(4-carbamimidoylphenyl)methyl]-N'-methylpropanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)NC)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)cc1 |
| InChI | InChI=1S/C23H38N10O4/c1-30-20(35)15(12-13-6-8-14(9-7-13)18(25)26)21(36)33-17(4-2-10-24)22(37)32-16(19(27)34)5-3-11-31-23(28)29/h6-9,15-17H,2-5,10-12,24H2,1H3,(H3,25,26)(H2,27,34)(H,30,35)(H,32,37)(H,33,36)(H4,28,29,31)/t15?,16-,17-/m0/s1 |
| InChIKey | VRIFBVNRTAMHOB-BSOSBYQFSA-N |
| XLogP | -2.88 |
| TPSA | 270.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|