C26H42N10O5 — CID 142651499
(2S)-5-amino-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-morpholin-4-yl-3-oxopropanoyl]amino]pentanamide (PubChem CID 142651499) has the molecular formula C26H42N10O5 and a molecular weight of 574.69 g/mol. Its IUPAC name is (2S)-5-amino-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-morpholin-4-yl-3-oxopropanoyl]amino]pentanamide.
| Compound Name | (2S)-5-amino-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-morpholin-4-yl-3-oxopropanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 142651499 |
| Molecular Formula | C26H42N10O5 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | (2S)-5-amino-N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-morpholin-4-yl-3-oxopropanoyl]amino]pentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)N[C@@H](CCCN)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H42N10O5/c27-9-1-3-20(24(39)34-19(22(30)37)4-2-10-33-26(31)32)35-23(38)18(25(40)36-11-13-41-14-12-36)15-16-5-7-17(8-6-16)21(28)29/h5-8,18-20H,1-4,9-15,27H2,(H3,28,29)(H2,30,37)(H,34,39)(H,35,38)(H4,31,32,33)/t18?,19-,20-/m0/s1 |
| InChIKey | HWLNDXSVXFHQEQ-YPJRHXLCSA-N |
| XLogP | -2.76 |
| TPSA | 271.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|