C28H44N8O5 — CID 10212067
(2S)-2-[[(2S)-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-(dimethylamino)-3-oxopropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10212067) has the molecular formula C28H44N8O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-(dimethylamino)-3-oxopropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-(dimethylamino)-3-oxopropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10212067 |
| Molecular Formula | C28H44N8O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[(4-carbamimidoylphenyl)methyl]-3-(dimethylamino)-3-oxopropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)N[C@@H](CC2CCCCC2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C28H44N8O5/c1-36(2)26(39)20(15-18-10-12-19(13-11-18)23(29)30)24(37)35-22(16-17-7-4-3-5-8-17)25(38)34-21(27(40)41)9-6-14-33-28(31)32/h10-13,17,20-22H,3-9,14-16H2,1-2H3,(H3,29,30)(H,34,38)(H,35,37)(H,40,41)(H4,31,32,33)/t20?,21-,22-/m0/s1 |
| InChIKey | FFSIKGOCCSHQFC-QIFDKBNDSA-N |
| XLogP | 0.30 |
| TPSA | 230.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|