C33H51F3N8O5 — CID 159129787
(2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 159129787) has the molecular formula C33H51F3N8O5 and a molecular weight of 696.82 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159129787 |
| Molecular Formula | C33H51F3N8O5 |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-3-cyclohexylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(C(=O)N[C@@H](CC2CCCCC2)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H50N8O3.C2HF3O2/c32-27(33)23-15-13-21(14-16-23)18-24(22-10-5-2-6-11-22)29(41)39-26(19-20-8-3-1-4-9-20)30(42)38-25(28(34)40)12-7-17-37-31(35)36;3-2(4,5)1(6)7/h13-16,20,22,24-26H,1-12,17-19H2,(H3,32,33)(H2,34,40)(H,38,42)(H,39,41)(H4,35,36,37);(H,6,7)/t24?,25-,26-;/m0./s1 |
| InChIKey | KLAPEBYCWNAYRA-MHTYAFTESA-N |
| XLogP | 2.82 |
| TPSA | 252.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|