C24H36ClN3O3 — CID 131724490
(2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetic acid;hydrochloride (PubChem CID 131724490) has the molecular formula C24H36ClN3O3 and a molecular weight of 450.02 g/mol. Its IUPAC name is (2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetic acid;hydrochloride.
| Compound Name | (2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetic acid;hydrochloride |
|---|---|
| PubChem CID | 131724490 |
| Molecular Formula | C24H36ClN3O3 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (2S)-2-[[3-(4-carbamimidoylphenyl)-2-cyclohexylpropanoyl]amino]-2-cyclohexylacetic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CC(C(=O)N[C@H](C(=O)O)C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H35N3O3.ClH/c25-22(26)19-13-11-16(12-14-19)15-20(17-7-3-1-4-8-17)23(28)27-21(24(29)30)18-9-5-2-6-10-18;/h11-14,17-18,20-21H,1-10,15H2,(H3,25,26)(H,27,28)(H,29,30);1H/t20?,21-;/m0./s1 |
| InChIKey | VNNYPIJFEIEOOB-NPTNJNKCSA-N |
| XLogP | 4.28 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|