C31H42FN7O2 — CID 23509879
3-(4-carbamimidoylphenyl)-N-[2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-(2-fluorophenyl)propanamide (PubChem CID 23509879) has the molecular formula C31H42FN7O2 and a molecular weight of 563.72 g/mol. Its IUPAC name is 3-(4-carbamimidoylphenyl)-N-[2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-(2-fluorophenyl)propanamide.
| Compound Name | 3-(4-carbamimidoylphenyl)-N-[2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 23509879 |
| Molecular Formula | C31H42FN7O2 |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | 3-(4-carbamimidoylphenyl)-N-[2-[(1-carbamimidoylpiperidin-4-yl)methylamino]-1-cyclohexyl-2-oxoethyl]-2-(2-fluorophenyl)propanamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(C(=O)NC(C(=O)NCC2CCN(/C(N)=N/[H])CC2)C2CCCCC2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C31H42FN7O2/c32-26-9-5-4-8-24(26)25(18-20-10-12-23(13-11-20)28(33)34)29(40)38-27(22-6-2-1-3-7-22)30(41)37-19-21-14-16-39(17-15-21)31(35)36/h4-5,8-13,21-22,25,27H,1-3,6-7,14-19H2,(H3,33,34)(H3,35,36)(H,37,41)(H,38,40) |
| InChIKey | RTOKJAYKJGDSFH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|