C34H41F3N8O5 — CID 159221240
(2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 159221240) has the molecular formula C34H41F3N8O5 and a molecular weight of 698.75 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159221240 |
| Molecular Formula | C34H41F3N8O5 |
| Molecular Weight | 698.75 g/mol |
| Exact Mass | 698.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[3-(4-carbamimidoylphenyl)-2-phenylpropanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H40N8O3.C2HF3O2/c1-40(31(43)25(23-11-6-3-7-12-23)19-22-14-16-24(17-15-22)28(33)34)27(20-21-9-4-2-5-10-21)30(42)39-26(29(35)41)13-8-18-38-32(36)37;3-2(4,5)1(6)7/h2-7,9-12,14-17,25-27H,8,13,18-20H2,1H3,(H3,33,34)(H2,35,41)(H,39,42)(H4,36,37,38);(H,6,7)/t25?,26-,27-;/m0./s1 |
| InChIKey | XOSQTKMGTXCKIY-YFGYHPHZSA-N |
| XLogP | 2.02 |
| TPSA | 244.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.75 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|