C24H38N6O4 — CID 159984039
4-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxopropan-2-yl]amino]cyclohexane-1-carboxylic acid (PubChem CID 159984039) has the molecular formula C24H38N6O4 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxopropan-2-yl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxopropan-2-yl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 159984039 |
| Molecular Formula | C24H38N6O4 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 4-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxopropan-2-yl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C[C@H](NC1CCC(C(=O)O)CC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C24H38N6O4/c1-16(29-19-11-9-18(10-12-19)23(33)34)21(31)30-20(8-5-14-28-24(25)26)22(32)27-15-13-17-6-3-2-4-7-17/h2-4,6-7,16,18-20,29H,5,8-15H2,1H3,(H,27,32)(H,30,31)(H,33,34)(H4,25,26,28)/t16-,18?,19?,20-/m0/s1 |
| InChIKey | WMQZLNOVETXBAB-ACAXCVFMSA-N |
| XLogP | 0.51 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|