C21H42N10O3 — CID 175751522
(2S)-2-[[(2S)-2-[[(2S)-2-(cyclohexylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 175751522) has the molecular formula C21H42N10O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-(cyclohexylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-(cyclohexylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 175751522 |
| Molecular Formula | C21H42N10O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-(cyclohexylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC1CCCCC1)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C21H42N10O3/c1-13(18(33)31-15(17(22)32)9-5-11-27-20(23)24)29-19(34)16(10-6-12-28-21(25)26)30-14-7-3-2-4-8-14/h13-16,30H,2-12H2,1H3,(H2,22,32)(H,29,34)(H,31,33)(H4,23,24,27)(H4,25,26,28)/t13-,15-,16-/m0/s1 |
| InChIKey | FWIZVOJTCHNIDX-BPUTZDHNSA-N |
| XLogP | -2.14 |
| TPSA | 242.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|